C17H24N2O3 — CID 119908992
1-[2-(2,6-diethylanilino)-2-oxoethyl]pyrrolidine-2-carboxylic acid (PubChem CID 119908992) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is 1-[2-(2,6-diethylanilino)-2-oxoethyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[2-(2,6-diethylanilino)-2-oxoethyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 119908992 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 1-[2-(2,6-diethylanilino)-2-oxoethyl]pyrrolidine-2-carboxylic acid |
| SMILES | CCc1cccc(CC)c1NC(=O)CN1CCCC1C(=O)O |
| InChI | InChI=1S/C17H24N2O3/c1-3-12-7-5-8-13(4-2)16(12)18-15(20)11-19-10-6-9-14(19)17(21)22/h5,7-8,14H,3-4,6,9-11H2,1-2H3,(H,18,20)(H,21,22) |
| InChIKey | GVDZPPQIIXPPAA-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |