C21H31NO2 — CID 11990921
(3S,6R,8R,10S,11S,13S)-2,2,6,13-tetramethyl-11-phenyl-9,12-dioxa-1-azatricyclo[8.4.0.03,8]tetradecane (PubChem CID 11990921) has the molecular formula C21H31NO2 and a molecular weight of 329.48 g/mol. Its IUPAC name is (3S,6R,8R,10S,11S,13S)-2,2,6,13-tetramethyl-11-phenyl-9,12-dioxa-1-azatricyclo[8.4.0.03,8]tetradecane.
| Compound Name | (3S,6R,8R,10S,11S,13S)-2,2,6,13-tetramethyl-11-phenyl-9,12-dioxa-1-azatricyclo[8.4.0.03,8]tetradecane |
|---|---|
| PubChem CID | 11990921 |
| Molecular Formula | C21H31NO2 |
| Molecular Weight | 329.48 g/mol |
| Exact Mass | 329.24 |
| IUPAC Name | (3S,6R,8R,10S,11S,13S)-2,2,6,13-tetramethyl-11-phenyl-9,12-dioxa-1-azatricyclo[8.4.0.03,8]tetradecane |
| SMILES | C[C@@H]1CC[C@@H]2[C@@H](C1)O[C@H]1[C@H](c3ccccc3)O[C@@H](C)CN1C2(C)C |
| InChI | InChI=1S/C21H31NO2/c1-14-10-11-17-18(12-14)24-20-19(16-8-6-5-7-9-16)23-15(2)13-22(20)21(17,3)4/h5-9,14-15,17-20H,10-13H2,1-4H3/t14-,15+,17-,18-,19+,20+/m1/s1 |
| InChIKey | NXBKUDSVRPIMPG-WOHUTOPTSA-N |
| XLogP | 4.39 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.48 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |