C22H33NO2 — CID 11990924
(3S,6R,8R,10S,11S,13R)-13-ethyl-2,2,6-trimethyl-11-phenyl-9,12-dioxa-1-azatricyclo[8.4.0.03,8]tetradecane (PubChem CID 11990924) has the molecular formula C22H33NO2 and a molecular weight of 343.51 g/mol. Its IUPAC name is (3S,6R,8R,10S,11S,13R)-13-ethyl-2,2,6-trimethyl-11-phenyl-9,12-dioxa-1-azatricyclo[8.4.0.03,8]tetradecane.
| Compound Name | (3S,6R,8R,10S,11S,13R)-13-ethyl-2,2,6-trimethyl-11-phenyl-9,12-dioxa-1-azatricyclo[8.4.0.03,8]tetradecane |
|---|---|
| PubChem CID | 11990924 |
| Molecular Formula | C22H33NO2 |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.25 |
| IUPAC Name | (3S,6R,8R,10S,11S,13R)-13-ethyl-2,2,6-trimethyl-11-phenyl-9,12-dioxa-1-azatricyclo[8.4.0.03,8]tetradecane |
| SMILES | CC[C@@H]1CN2[C@@H](O[C@@H]3C[C@H](C)CC[C@H]3C2(C)C)[C@H](c2ccccc2)O1 |
| InChI | InChI=1S/C22H33NO2/c1-5-17-14-23-21(20(24-17)16-9-7-6-8-10-16)25-19-13-15(2)11-12-18(19)22(23,3)4/h6-10,15,17-21H,5,11-14H2,1-4H3/t15-,17-,18-,19-,20+,21+/m1/s1 |
| InChIKey | FGXAGHWKSJXWSL-HYMUMSMOSA-N |
| XLogP | 4.78 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |