C15H27NO2 — CID 11990925
(3S,6R,8R,10S,13R)-2,2,6,13-tetramethyl-9,12-dioxa-1-azatricyclo[8.4.0.03,8]tetradecane (PubChem CID 11990925) has the molecular formula C15H27NO2 and a molecular weight of 253.39 g/mol. Its IUPAC name is (3S,6R,8R,10S,13R)-2,2,6,13-tetramethyl-9,12-dioxa-1-azatricyclo[8.4.0.03,8]tetradecane.
| Compound Name | (3S,6R,8R,10S,13R)-2,2,6,13-tetramethyl-9,12-dioxa-1-azatricyclo[8.4.0.03,8]tetradecane |
|---|---|
| PubChem CID | 11990925 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | (3S,6R,8R,10S,13R)-2,2,6,13-tetramethyl-9,12-dioxa-1-azatricyclo[8.4.0.03,8]tetradecane |
| SMILES | C[C@@H]1CC[C@@H]2[C@@H](C1)O[C@H]1CO[C@H](C)CN1C2(C)C |
| InChI | InChI=1S/C15H27NO2/c1-10-5-6-12-13(7-10)18-14-9-17-11(2)8-16(14)15(12,3)4/h10-14H,5-9H2,1-4H3/t10-,11-,12-,13-,14+/m1/s1 |
| InChIKey | SCTOJKSILQIPJZ-KSTCHIGDSA-N |
| XLogP | 2.65 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |