C11H19ClN2O3 — CID 119909272
1-[2-[cyclopropyl(methyl)amino]-2-oxoethyl]pyrrolidine-2-carboxylic acid;hydrochloride (PubChem CID 119909272) has the molecular formula C11H19ClN2O3 and a molecular weight of 262.74 g/mol. Its IUPAC name is 1-[2-[cyclopropyl(methyl)amino]-2-oxoethyl]pyrrolidine-2-carboxylic acid;hydrochloride.
| Compound Name | 1-[2-[cyclopropyl(methyl)amino]-2-oxoethyl]pyrrolidine-2-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 119909272 |
| Molecular Formula | C11H19ClN2O3 |
| Molecular Weight | 262.74 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 1-[2-[cyclopropyl(methyl)amino]-2-oxoethyl]pyrrolidine-2-carboxylic acid;hydrochloride |
| SMILES | CN(C(=O)CN1CCCC1C(=O)O)C1CC1.Cl |
| InChI | InChI=1S/C11H18N2O3.ClH/c1-12(8-4-5-8)10(14)7-13-6-2-3-9(13)11(15)16;/h8-9H,2-7H2,1H3,(H,15,16);1H |
| InChIKey | UZXNERNYTJPFCX-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.74 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |