About 2-(113C)methyl(1,2,3-13C3)prop-1-ene
2-(113C)methyl(1,2,3-13C3)prop-1-ene (PubChem CID 11990935) has the molecular formula C4H8
and a molecular weight of 60.08 g/mol. Its IUPAC name is 2-(113C)methyl(1,2,3-13C3)prop-1-ene.
Molecular Properties
| Compound Name | 2-(113C)methyl(1,2,3-13C3)prop-1-ene |
| PubChem CID | 11990935 |
| Molecular Formula | C4H8 |
| Molecular Weight | 60.08 g/mol |
| Exact Mass | 60.08 |
| IUPAC Name | 2-(113C)methyl(1,2,3-13C3)prop-1-ene |
| SMILES | [13CH2]=[13C]([13CH3])[13CH3] |
| InChI | InChI=1S/C4H8/c1-4(2)3/h1H2,2-3H3/i1+1,2+1,3+1,4+1 |
| InChIKey | VQTUBCCKSQIDNK-JCDJMFQYSA-N |
| XLogP | 1.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 4 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 60.08 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(113C)methyl(1,2,3-13C3)prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(113C)methyl(1,2,3-13C3)prop-1-ene?
The IUPAC name of 2-(113C)methyl(1,2,3-13C3)prop-1-ene (CID 11990935) is 2-(113C)methyl(1,2,3-13C3)prop-1-ene.
What is the SMILES notation for 2-(113C)methyl(1,2,3-13C3)prop-1-ene?
The canonical SMILES for 2-(113C)methyl(1,2,3-13C3)prop-1-ene is [13CH2]=[13C]([13CH3])[13CH3].
What is the InChIKey of 2-(113C)methyl(1,2,3-13C3)prop-1-ene?
The InChIKey is VQTUBCCKSQIDNK-JCDJMFQYSA-N. The full InChI is InChI=1S/C4H8/c1-4(2)3/h1H2,2-3H3/i1+1,2+1,3+1,4+1.
What are the key properties of 2-(113C)methyl(1,2,3-13C3)prop-1-ene?
2-(113C)methyl(1,2,3-13C3)prop-1-ene has a molecular weight of 60.08 g/mol, XLogP of 1.58, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(113C)methyl(1,2,3-13C3)prop-1-ene is sourced from PubChem (CID 11990935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).