About [1-[2-(1,2,4-triazol-1-yl)ethyl]piperidin-4-yl]methanamine
[1-[2-(1,2,4-triazol-1-yl)ethyl]piperidin-4-yl]methanamine (PubChem CID 119909413) has the molecular formula C10H19N5
and a molecular weight of 209.30 g/mol. Its IUPAC name is [1-[2-(1,2,4-triazol-1-yl)ethyl]piperidin-4-yl]methanamine.
Molecular Properties
| Compound Name | [1-[2-(1,2,4-triazol-1-yl)ethyl]piperidin-4-yl]methanamine |
| PubChem CID | 119909413 |
| Molecular Formula | C10H19N5 |
| Molecular Weight | 209.30 g/mol |
| Exact Mass | 209.16 |
| IUPAC Name | [1-[2-(1,2,4-triazol-1-yl)ethyl]piperidin-4-yl]methanamine |
| SMILES | NCC1CCN(CCn2cncn2)CC1 |
| InChI | InChI=1S/C10H19N5/c11-7-10-1-3-14(4-2-10)5-6-15-9-12-8-13-15/h8-10H,1-7,11H2 |
| InChIKey | JXAOFOUXHBGTGD-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.30 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-[2-(1,2,4-triazol-1-yl)ethyl]piperidin-4-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[2-(1,2,4-triazol-1-yl)ethyl]piperidin-4-yl]methanamine?
The IUPAC name of [1-[2-(1,2,4-triazol-1-yl)ethyl]piperidin-4-yl]methanamine (CID 119909413) is [1-[2-(1,2,4-triazol-1-yl)ethyl]piperidin-4-yl]methanamine.
What is the SMILES notation for [1-[2-(1,2,4-triazol-1-yl)ethyl]piperidin-4-yl]methanamine?
The canonical SMILES for [1-[2-(1,2,4-triazol-1-yl)ethyl]piperidin-4-yl]methanamine is NCC1CCN(CCn2cncn2)CC1.
What is the InChIKey of [1-[2-(1,2,4-triazol-1-yl)ethyl]piperidin-4-yl]methanamine?
The InChIKey is JXAOFOUXHBGTGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N5/c11-7-10-1-3-14(4-2-10)5-6-15-9-12-8-13-15/h8-10H,1-7,11H2.
What are the key properties of [1-[2-(1,2,4-triazol-1-yl)ethyl]piperidin-4-yl]methanamine?
[1-[2-(1,2,4-triazol-1-yl)ethyl]piperidin-4-yl]methanamine has a molecular weight of 209.30 g/mol, XLogP of -0.05, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[2-(1,2,4-triazol-1-yl)ethyl]piperidin-4-yl]methanamine is sourced from PubChem (CID 119909413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).