About 6-[[4-(aminomethyl)piperidin-1-yl]methyl]-1,3-dimethylpyrimidine-2,4-dione;hydrochloride
6-[[4-(aminomethyl)piperidin-1-yl]methyl]-1,3-dimethylpyrimidine-2,4-dione;hydrochloride (PubChem CID 119909687) has the molecular formula C13H23ClN4O2
and a molecular weight of 302.81 g/mol. Its IUPAC name is 6-[[4-(aminomethyl)piperidin-1-yl]methyl]-1,3-dimethylpyrimidine-2,4-dione;hydrochloride.
Molecular Properties
| Compound Name | 6-[[4-(aminomethyl)piperidin-1-yl]methyl]-1,3-dimethylpyrimidine-2,4-dione;hydrochloride |
| PubChem CID | 119909687 |
| Molecular Formula | C13H23ClN4O2 |
| Molecular Weight | 302.81 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 6-[[4-(aminomethyl)piperidin-1-yl]methyl]-1,3-dimethylpyrimidine-2,4-dione;hydrochloride |
| SMILES | Cl.Cn1c(CN2CCC(CN)CC2)cc(=O)n(C)c1=O |
| InChI | InChI=1S/C13H22N4O2.ClH/c1-15-11(7-12(18)16(2)13(15)19)9-17-5-3-10(8-14)4-6-17;/h7,10H,3-6,8-9,14H2,1-2H3;1H |
| InChIKey | XAALNHMGDUNOFU-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 73.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.81 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-[[4-(aminomethyl)piperidin-1-yl]methyl]-1,3-dimethylpyrimidine-2,4-dione;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[4-(aminomethyl)piperidin-1-yl]methyl]-1,3-dimethylpyrimidine-2,4-dione;hydrochloride?
The IUPAC name of 6-[[4-(aminomethyl)piperidin-1-yl]methyl]-1,3-dimethylpyrimidine-2,4-dione;hydrochloride (CID 119909687) is 6-[[4-(aminomethyl)piperidin-1-yl]methyl]-1,3-dimethylpyrimidine-2,4-dione;hydrochloride.
What is the SMILES notation for 6-[[4-(aminomethyl)piperidin-1-yl]methyl]-1,3-dimethylpyrimidine-2,4-dione;hydrochloride?
The canonical SMILES for 6-[[4-(aminomethyl)piperidin-1-yl]methyl]-1,3-dimethylpyrimidine-2,4-dione;hydrochloride is Cl.Cn1c(CN2CCC(CN)CC2)cc(=O)n(C)c1=O.
What is the InChIKey of 6-[[4-(aminomethyl)piperidin-1-yl]methyl]-1,3-dimethylpyrimidine-2,4-dione;hydrochloride?
The InChIKey is XAALNHMGDUNOFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N4O2.ClH/c1-15-11(7-12(18)16(2)13(15)19)9-17-5-3-10(8-14)4-6-17;/h7,10H,3-6,8-9,14H2,1-2H3;1H.
What are the key properties of 6-[[4-(aminomethyl)piperidin-1-yl]methyl]-1,3-dimethylpyrimidine-2,4-dione;hydrochloride?
6-[[4-(aminomethyl)piperidin-1-yl]methyl]-1,3-dimethylpyrimidine-2,4-dione;hydrochloride has a molecular weight of 302.81 g/mol, XLogP of -0.32, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[4-(aminomethyl)piperidin-1-yl]methyl]-1,3-dimethylpyrimidine-2,4-dione;hydrochloride is sourced from PubChem (CID 119909687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).