C13H19ClIN3O — CID 119910140
2-(3-aminopiperidin-1-yl)-N-(3-iodophenyl)acetamide;hydrochloride (PubChem CID 119910140) has the molecular formula C13H19ClIN3O and a molecular weight of 395.67 g/mol. Its IUPAC name is 2-(3-aminopiperidin-1-yl)-N-(3-iodophenyl)acetamide;hydrochloride.
| Compound Name | 2-(3-aminopiperidin-1-yl)-N-(3-iodophenyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119910140 |
| Molecular Formula | C13H19ClIN3O |
| Molecular Weight | 395.67 g/mol |
| Exact Mass | 395.03 |
| IUPAC Name | 2-(3-aminopiperidin-1-yl)-N-(3-iodophenyl)acetamide;hydrochloride |
| SMILES | Cl.NC1CCCN(CC(=O)Nc2cccc(I)c2)C1 |
| InChI | InChI=1S/C13H18IN3O.ClH/c14-10-3-1-5-12(7-10)16-13(18)9-17-6-2-4-11(15)8-17;/h1,3,5,7,11H,2,4,6,8-9,15H2,(H,16,18);1H |
| InChIKey | FICRJRKBDQXXNN-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.67 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|