C12H25ClN4O2 — CID 119910993
3-[2-(1-aminoethyl)piperidin-1-yl]-N-(methylcarbamoyl)propanamide;hydrochloride (PubChem CID 119910993) has the molecular formula C12H25ClN4O2 and a molecular weight of 292.81 g/mol. Its IUPAC name is 3-[2-(1-aminoethyl)piperidin-1-yl]-N-(methylcarbamoyl)propanamide;hydrochloride.
| Compound Name | 3-[2-(1-aminoethyl)piperidin-1-yl]-N-(methylcarbamoyl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 119910993 |
| Molecular Formula | C12H25ClN4O2 |
| Molecular Weight | 292.81 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | 3-[2-(1-aminoethyl)piperidin-1-yl]-N-(methylcarbamoyl)propanamide;hydrochloride |
| SMILES | CNC(=O)NC(=O)CCN1CCCCC1C(C)N.Cl |
| InChI | InChI=1S/C12H24N4O2.ClH/c1-9(13)10-5-3-4-7-16(10)8-6-11(17)15-12(18)14-2;/h9-10H,3-8,13H2,1-2H3,(H2,14,15,17,18);1H |
| InChIKey | ZTRMBCJDBDWUIA-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.81 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |