C15H24ClN3O — CID 119911778
3-[[2-(1-aminoethyl)piperidin-1-yl]methyl]benzamide;hydrochloride (PubChem CID 119911778) has the molecular formula C15H24ClN3O and a molecular weight of 297.83 g/mol. Its IUPAC name is 3-[[2-(1-aminoethyl)piperidin-1-yl]methyl]benzamide;hydrochloride.
| Compound Name | 3-[[2-(1-aminoethyl)piperidin-1-yl]methyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 119911778 |
| Molecular Formula | C15H24ClN3O |
| Molecular Weight | 297.83 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | 3-[[2-(1-aminoethyl)piperidin-1-yl]methyl]benzamide;hydrochloride |
| SMILES | CC(N)C1CCCCN1Cc1cccc(C(N)=O)c1.Cl |
| InChI | InChI=1S/C15H23N3O.ClH/c1-11(16)14-7-2-3-8-18(14)10-12-5-4-6-13(9-12)15(17)19;/h4-6,9,11,14H,2-3,7-8,10,16H2,1H3,(H2,17,19);1H |
| InChIKey | VJQZGNNGIXAVTK-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.83 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |