C31H27NO — CID 11991234
(2S,4S)-2-anthracen-9-yl-3,4-dibenzyl-1,3-oxazolidine (PubChem CID 11991234) has the molecular formula C31H27NO and a molecular weight of 429.56 g/mol. Its IUPAC name is (2S,4S)-2-anthracen-9-yl-3,4-dibenzyl-1,3-oxazolidine.
| Compound Name | (2S,4S)-2-anthracen-9-yl-3,4-dibenzyl-1,3-oxazolidine |
|---|---|
| PubChem CID | 11991234 |
| Molecular Formula | C31H27NO |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | (2S,4S)-2-anthracen-9-yl-3,4-dibenzyl-1,3-oxazolidine |
| SMILES | c1ccc(C[C@H]2CO[C@@H](c3c4ccccc4cc4ccccc34)N2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C31H27NO/c1-3-11-23(12-4-1)19-27-22-33-31(32(27)21-24-13-5-2-6-14-24)30-28-17-9-7-15-25(28)20-26-16-8-10-18-29(26)30/h1-18,20,27,31H,19,21-22H2/t27-,31-/m0/s1 |
| InChIKey | FQLRWIWWHIFQIV-DHIFEGFHSA-N |
| XLogP | 7.14 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|