C11H14ClFN2O4 — CID 119912726
2-[(5-fluoro-2-nitrophenyl)methyl-methylamino]propanoic acid;hydrochloride (PubChem CID 119912726) has the molecular formula C11H14ClFN2O4 and a molecular weight of 292.69 g/mol. Its IUPAC name is 2-[(5-fluoro-2-nitrophenyl)methyl-methylamino]propanoic acid;hydrochloride.
| Compound Name | 2-[(5-fluoro-2-nitrophenyl)methyl-methylamino]propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 119912726 |
| Molecular Formula | C11H14ClFN2O4 |
| Molecular Weight | 292.69 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 2-[(5-fluoro-2-nitrophenyl)methyl-methylamino]propanoic acid;hydrochloride |
| SMILES | CC(C(=O)O)N(C)Cc1cc(F)ccc1[N+](=O)[O-].Cl |
| InChI | InChI=1S/C11H13FN2O4.ClH/c1-7(11(15)16)13(2)6-8-5-9(12)3-4-10(8)14(17)18;/h3-5,7H,6H2,1-2H3,(H,15,16);1H |
| InChIKey | BVPMUYDLLLJQHO-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 83.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.69 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|