About (2S,4S)-2-anthracen-9-yl-4-benzyl-3-methyl-1,3-oxazolidine
(2S,4S)-2-anthracen-9-yl-4-benzyl-3-methyl-1,3-oxazolidine (PubChem CID 11991291) has the molecular formula C25H23NO
and a molecular weight of 353.47 g/mol. Its IUPAC name is (2S,4S)-2-anthracen-9-yl-4-benzyl-3-methyl-1,3-oxazolidine.
Molecular Properties
| Compound Name | (2S,4S)-2-anthracen-9-yl-4-benzyl-3-methyl-1,3-oxazolidine |
| PubChem CID | 11991291 |
| Molecular Formula | C25H23NO |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | (2S,4S)-2-anthracen-9-yl-4-benzyl-3-methyl-1,3-oxazolidine |
| SMILES | CN1[C@@H](Cc2ccccc2)CO[C@H]1c1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C25H23NO/c1-26-21(15-18-9-3-2-4-10-18)17-27-25(26)24-22-13-7-5-11-19(22)16-20-12-6-8-14-23(20)24/h2-14,16,21,25H,15,17H2,1H3/t21-,25-/m0/s1 |
| InChIKey | YUCGDSWHTSHFKO-OFVILXPXSA-N |
| XLogP | 5.56 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze (2S,4S)-2-anthracen-9-yl-4-benzyl-3-methyl-1,3-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,4S)-2-anthracen-9-yl-4-benzyl-3-methyl-1,3-oxazolidine?
The IUPAC name of (2S,4S)-2-anthracen-9-yl-4-benzyl-3-methyl-1,3-oxazolidine (CID 11991291) is (2S,4S)-2-anthracen-9-yl-4-benzyl-3-methyl-1,3-oxazolidine.
What is the SMILES notation for (2S,4S)-2-anthracen-9-yl-4-benzyl-3-methyl-1,3-oxazolidine?
The canonical SMILES for (2S,4S)-2-anthracen-9-yl-4-benzyl-3-methyl-1,3-oxazolidine is CN1[C@@H](Cc2ccccc2)CO[C@H]1c1c2ccccc2cc2ccccc12.
What is the InChIKey of (2S,4S)-2-anthracen-9-yl-4-benzyl-3-methyl-1,3-oxazolidine?
The InChIKey is YUCGDSWHTSHFKO-OFVILXPXSA-N. The full InChI is InChI=1S/C25H23NO/c1-26-21(15-18-9-3-2-4-10-18)17-27-25(26)24-22-13-7-5-11-19(22)16-20-12-6-8-14-23(20)24/h2-14,16,21,25H,15,17H2,1H3/t21-,25-/m0/s1.
What are the key properties of (2S,4S)-2-anthracen-9-yl-4-benzyl-3-methyl-1,3-oxazolidine?
(2S,4S)-2-anthracen-9-yl-4-benzyl-3-methyl-1,3-oxazolidine has a molecular weight of 353.47 g/mol, XLogP of 5.56, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,4S)-2-anthracen-9-yl-4-benzyl-3-methyl-1,3-oxazolidine is sourced from PubChem (CID 11991291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).