C16H32ClN3O — CID 119912963
N-methyl-N-(4-methylcyclohexyl)-2-[methyl(piperidin-4-yl)amino]acetamide;hydrochloride (PubChem CID 119912963) has the molecular formula C16H32ClN3O and a molecular weight of 317.91 g/mol. Its IUPAC name is N-methyl-N-(4-methylcyclohexyl)-2-[methyl(piperidin-4-yl)amino]acetamide;hydrochloride.
| Compound Name | N-methyl-N-(4-methylcyclohexyl)-2-[methyl(piperidin-4-yl)amino]acetamide;hydrochloride |
|---|---|
| PubChem CID | 119912963 |
| Molecular Formula | C16H32ClN3O |
| Molecular Weight | 317.91 g/mol |
| Exact Mass | 317.22 |
| IUPAC Name | N-methyl-N-(4-methylcyclohexyl)-2-[methyl(piperidin-4-yl)amino]acetamide;hydrochloride |
| SMILES | CC1CCC(N(C)C(=O)CN(C)C2CCNCC2)CC1.Cl |
| InChI | InChI=1S/C16H31N3O.ClH/c1-13-4-6-15(7-5-13)19(3)16(20)12-18(2)14-8-10-17-11-9-14;/h13-15,17H,4-12H2,1-3H3;1H |
| InChIKey | HPLZNWNWXGVLGO-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.91 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |