About [(3R,5S)-7-cyano-3-[(4-fluorophenyl)methyl]-5-methylsulfonyloxyheptyl] methanesulfonate
[(3R,5S)-7-cyano-3-[(4-fluorophenyl)methyl]-5-methylsulfonyloxyheptyl] methanesulfonate (PubChem CID 11991363) has the molecular formula C17H24FNO6S2
and a molecular weight of 421.51 g/mol. Its IUPAC name is [(3R,5S)-7-cyano-3-[(4-fluorophenyl)methyl]-5-methylsulfonyloxyheptyl] methanesulfonate.
Molecular Properties
| Compound Name | [(3R,5S)-7-cyano-3-[(4-fluorophenyl)methyl]-5-methylsulfonyloxyheptyl] methanesulfonate |
| PubChem CID | 11991363 |
| Molecular Formula | C17H24FNO6S2 |
| Molecular Weight | 421.51 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | [(3R,5S)-7-cyano-3-[(4-fluorophenyl)methyl]-5-methylsulfonyloxyheptyl] methanesulfonate |
| SMILES | CS(=O)(=O)OCCC(Cc1ccc(F)cc1)C[C@H](CCC#N)OS(C)(=O)=O |
| InChI | InChI=1S/C17H24FNO6S2/c1-26(20,21)24-11-9-15(12-14-5-7-16(18)8-6-14)13-17(4-3-10-19)25-27(2,22)23/h5-8,15,17H,3-4,9,11-13H2,1-2H3/t15?,17-/m0/s1 |
| InChIKey | OPXBIHGQMQBSCD-LWKPJOBUSA-N |
| XLogP | 2.39 |
| TPSA | 110.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.51 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [(3R,5S)-7-cyano-3-[(4-fluorophenyl)methyl]-5-methylsulfonyloxyheptyl] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,5S)-7-cyano-3-[(4-fluorophenyl)methyl]-5-methylsulfonyloxyheptyl] methanesulfonate?
The IUPAC name of [(3R,5S)-7-cyano-3-[(4-fluorophenyl)methyl]-5-methylsulfonyloxyheptyl] methanesulfonate (CID 11991363) is [(3R,5S)-7-cyano-3-[(4-fluorophenyl)methyl]-5-methylsulfonyloxyheptyl] methanesulfonate.
What is the SMILES notation for [(3R,5S)-7-cyano-3-[(4-fluorophenyl)methyl]-5-methylsulfonyloxyheptyl] methanesulfonate?
The canonical SMILES for [(3R,5S)-7-cyano-3-[(4-fluorophenyl)methyl]-5-methylsulfonyloxyheptyl] methanesulfonate is CS(=O)(=O)OCCC(Cc1ccc(F)cc1)C[C@H](CCC#N)OS(C)(=O)=O.
What is the InChIKey of [(3R,5S)-7-cyano-3-[(4-fluorophenyl)methyl]-5-methylsulfonyloxyheptyl] methanesulfonate?
The InChIKey is OPXBIHGQMQBSCD-LWKPJOBUSA-N. The full InChI is InChI=1S/C17H24FNO6S2/c1-26(20,21)24-11-9-15(12-14-5-7-16(18)8-6-14)13-17(4-3-10-19)25-27(2,22)23/h5-8,15,17H,3-4,9,11-13H2,1-2H3/t15?,17-/m0/s1.
What are the key properties of [(3R,5S)-7-cyano-3-[(4-fluorophenyl)methyl]-5-methylsulfonyloxyheptyl] methanesulfonate?
[(3R,5S)-7-cyano-3-[(4-fluorophenyl)methyl]-5-methylsulfonyloxyheptyl] methanesulfonate has a molecular weight of 421.51 g/mol, XLogP of 2.39, 12 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,5S)-7-cyano-3-[(4-fluorophenyl)methyl]-5-methylsulfonyloxyheptyl] methanesulfonate is sourced from PubChem (CID 11991363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).