C15H28ClN3O4 — CID 119913641
2-[methyl-[2-oxo-2-[3-(2-oxoazepan-1-yl)propylamino]ethyl]amino]propanoic acid;hydrochloride (PubChem CID 119913641) has the molecular formula C15H28ClN3O4 and a molecular weight of 349.86 g/mol. Its IUPAC name is 2-[methyl-[2-oxo-2-[3-(2-oxoazepan-1-yl)propylamino]ethyl]amino]propanoic acid;hydrochloride.
| Compound Name | 2-[methyl-[2-oxo-2-[3-(2-oxoazepan-1-yl)propylamino]ethyl]amino]propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 119913641 |
| Molecular Formula | C15H28ClN3O4 |
| Molecular Weight | 349.86 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | 2-[methyl-[2-oxo-2-[3-(2-oxoazepan-1-yl)propylamino]ethyl]amino]propanoic acid;hydrochloride |
| SMILES | CC(C(=O)O)N(C)CC(=O)NCCCN1CCCCCC1=O.Cl |
| InChI | InChI=1S/C15H27N3O4.ClH/c1-12(15(21)22)17(2)11-13(19)16-8-6-10-18-9-5-3-4-7-14(18)20;/h12H,3-11H2,1-2H3,(H,16,19)(H,21,22);1H |
| InChIKey | GXCDWZOVEIJGLG-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.86 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|