C17H24ClFN2O4 — CID 119914065
(2R)-1-[2-[3-(4-fluorophenoxy)propyl-methylamino]-2-oxoethyl]pyrrolidine-2-carboxylic acid;hydrochloride (PubChem CID 119914065) has the molecular formula C17H24ClFN2O4 and a molecular weight of 374.84 g/mol. Its IUPAC name is (2R)-1-[2-[3-(4-fluorophenoxy)propyl-methylamino]-2-oxoethyl]pyrrolidine-2-carboxylic acid;hydrochloride.
| Compound Name | (2R)-1-[2-[3-(4-fluorophenoxy)propyl-methylamino]-2-oxoethyl]pyrrolidine-2-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 119914065 |
| Molecular Formula | C17H24ClFN2O4 |
| Molecular Weight | 374.84 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | (2R)-1-[2-[3-(4-fluorophenoxy)propyl-methylamino]-2-oxoethyl]pyrrolidine-2-carboxylic acid;hydrochloride |
| SMILES | CN(CCCOc1ccc(F)cc1)C(=O)CN1CCC[C@@H]1C(=O)O.Cl |
| InChI | InChI=1S/C17H23FN2O4.ClH/c1-19(9-3-11-24-14-7-5-13(18)6-8-14)16(21)12-20-10-2-4-15(20)17(22)23;/h5-8,15H,2-4,9-12H2,1H3,(H,22,23);1H/t15-;/m1./s1 |
| InChIKey | CZMDNJUFPOWCGP-XFULWGLBSA-N |
| XLogP | 2.02 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.84 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|