C9H13NO2 — CID 11991494
(3aR,8aR,8bR)-3,3a,4,6,7,8,8a,8b-octahydrofuro[2,3-a]pyrrolizin-2-one (PubChem CID 11991494) has the molecular formula C9H13NO2 and a molecular weight of 167.21 g/mol. Its IUPAC name is (3aR,8aR,8bR)-3,3a,4,6,7,8,8a,8b-octahydrofuro[2,3-a]pyrrolizin-2-one.
| Compound Name | (3aR,8aR,8bR)-3,3a,4,6,7,8,8a,8b-octahydrofuro[2,3-a]pyrrolizin-2-one |
|---|---|
| PubChem CID | 11991494 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | (3aR,8aR,8bR)-3,3a,4,6,7,8,8a,8b-octahydrofuro[2,3-a]pyrrolizin-2-one |
| SMILES | O=C1C[C@@H]2CN3CCC[C@@H]3[C@@H]2O1 |
| InChI | InChI=1S/C9H13NO2/c11-8-4-6-5-10-3-1-2-7(10)9(6)12-8/h6-7,9H,1-5H2/t6-,7-,9-/m1/s1 |
| InChIKey | UEYDKTNHDQBTHW-ZXFLCMHBSA-N |
| XLogP | 0.40 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |