C12H23ClN4O2 — CID 119914949
N-cyclopropyl-2-[methyl-(2-oxo-2-piperazin-1-ylethyl)amino]acetamide;hydrochloride (PubChem CID 119914949) has the molecular formula C12H23ClN4O2 and a molecular weight of 290.80 g/mol. Its IUPAC name is N-cyclopropyl-2-[methyl-(2-oxo-2-piperazin-1-ylethyl)amino]acetamide;hydrochloride.
| Compound Name | N-cyclopropyl-2-[methyl-(2-oxo-2-piperazin-1-ylethyl)amino]acetamide;hydrochloride |
|---|---|
| PubChem CID | 119914949 |
| Molecular Formula | C12H23ClN4O2 |
| Molecular Weight | 290.80 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | N-cyclopropyl-2-[methyl-(2-oxo-2-piperazin-1-ylethyl)amino]acetamide;hydrochloride |
| SMILES | CN(CC(=O)NC1CC1)CC(=O)N1CCNCC1.Cl |
| InChI | InChI=1S/C12H22N4O2.ClH/c1-15(8-11(17)14-10-2-3-10)9-12(18)16-6-4-13-5-7-16;/h10,13H,2-9H2,1H3,(H,14,17);1H |
| InChIKey | IBLYGSQXVUWYIU-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.80 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |