C11H17NO2 — CID 11991496
(1R,2R,6R)-3-oxa-8-azatricyclo[6.5.0.02,6]tridecan-4-one (PubChem CID 11991496) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is (1R,2R,6R)-3-oxa-8-azatricyclo[6.5.0.02,6]tridecan-4-one.
| Compound Name | (1R,2R,6R)-3-oxa-8-azatricyclo[6.5.0.02,6]tridecan-4-one |
|---|---|
| PubChem CID | 11991496 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | (1R,2R,6R)-3-oxa-8-azatricyclo[6.5.0.02,6]tridecan-4-one |
| SMILES | O=C1C[C@@H]2CN3CCCCC[C@@H]3[C@@H]2O1 |
| InChI | InChI=1S/C11H17NO2/c13-10-6-8-7-12-5-3-1-2-4-9(12)11(8)14-10/h8-9,11H,1-7H2/t8-,9-,11-/m1/s1 |
| InChIKey | MLGJKGJJUBEJKQ-FXPVBKGRSA-N |
| XLogP | 1.18 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |