C16H23ClN4O3 — CID 119915267
N-(3-chloro-4-methoxyphenyl)-2-[methyl-(2-oxo-2-piperazin-1-ylethyl)amino]acetamide (PubChem CID 119915267) has the molecular formula C16H23ClN4O3 and a molecular weight of 354.84 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-2-[methyl-(2-oxo-2-piperazin-1-ylethyl)amino]acetamide.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-2-[methyl-(2-oxo-2-piperazin-1-ylethyl)amino]acetamide |
|---|---|
| PubChem CID | 119915267 |
| Molecular Formula | C16H23ClN4O3 |
| Molecular Weight | 354.84 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-2-[methyl-(2-oxo-2-piperazin-1-ylethyl)amino]acetamide |
| SMILES | COc1ccc(NC(=O)CN(C)CC(=O)N2CCNCC2)cc1Cl |
| InChI | InChI=1S/C16H23ClN4O3/c1-20(11-16(23)21-7-5-18-6-8-21)10-15(22)19-12-3-4-14(24-2)13(17)9-12/h3-4,9,18H,5-8,10-11H2,1-2H3,(H,19,22) |
| InChIKey | FIYHKXUGFGFYNK-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.84 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |