C12H19NO2 — CID 11991551
(3aR,4S,8aR,8bR)-4-propyl-3,3a,4,6,7,8,8a,8b-octahydrofuro[2,3-a]pyrrolizin-2-one (PubChem CID 11991551) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is (3aR,4S,8aR,8bR)-4-propyl-3,3a,4,6,7,8,8a,8b-octahydrofuro[2,3-a]pyrrolizin-2-one.
| Compound Name | (3aR,4S,8aR,8bR)-4-propyl-3,3a,4,6,7,8,8a,8b-octahydrofuro[2,3-a]pyrrolizin-2-one |
|---|---|
| PubChem CID | 11991551 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | (3aR,4S,8aR,8bR)-4-propyl-3,3a,4,6,7,8,8a,8b-octahydrofuro[2,3-a]pyrrolizin-2-one |
| SMILES | CCC[C@H]1[C@H]2CC(=O)O[C@H]2[C@H]2CCCN21 |
| InChI | InChI=1S/C12H19NO2/c1-2-4-9-8-7-11(14)15-12(8)10-5-3-6-13(9)10/h8-10,12H,2-7H2,1H3/t8-,9+,10-,12-/m1/s1 |
| InChIKey | OUELSTDGTVEZBN-DTHBNOIPSA-N |
| XLogP | 1.56 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |