C15H24ClN3O — CID 119916209
2-[2-(aminomethyl)piperidin-1-yl]-N-methyl-N-phenylacetamide;hydrochloride (PubChem CID 119916209) has the molecular formula C15H24ClN3O and a molecular weight of 297.83 g/mol. Its IUPAC name is 2-[2-(aminomethyl)piperidin-1-yl]-N-methyl-N-phenylacetamide;hydrochloride.
| Compound Name | 2-[2-(aminomethyl)piperidin-1-yl]-N-methyl-N-phenylacetamide;hydrochloride |
|---|---|
| PubChem CID | 119916209 |
| Molecular Formula | C15H24ClN3O |
| Molecular Weight | 297.83 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | 2-[2-(aminomethyl)piperidin-1-yl]-N-methyl-N-phenylacetamide;hydrochloride |
| SMILES | CN(C(=O)CN1CCCCC1CN)c1ccccc1.Cl |
| InChI | InChI=1S/C15H23N3O.ClH/c1-17(13-7-3-2-4-8-13)15(19)12-18-10-6-5-9-14(18)11-16;/h2-4,7-8,14H,5-6,9-12,16H2,1H3;1H |
| InChIKey | COYWIXASDBMWOV-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.83 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |