About [1-[(2-methyl-1,2,4-triazol-3-yl)methyl]piperidin-2-yl]methanamine;dihydrochloride
[1-[(2-methyl-1,2,4-triazol-3-yl)methyl]piperidin-2-yl]methanamine;dihydrochloride (PubChem CID 119916298) has the molecular formula C10H21Cl2N5
and a molecular weight of 282.22 g/mol. Its IUPAC name is [1-[(2-methyl-1,2,4-triazol-3-yl)methyl]piperidin-2-yl]methanamine;dihydrochloride.
Molecular Properties
| Compound Name | [1-[(2-methyl-1,2,4-triazol-3-yl)methyl]piperidin-2-yl]methanamine;dihydrochloride |
| PubChem CID | 119916298 |
| Molecular Formula | C10H21Cl2N5 |
| Molecular Weight | 282.22 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | [1-[(2-methyl-1,2,4-triazol-3-yl)methyl]piperidin-2-yl]methanamine;dihydrochloride |
| SMILES | Cl.Cl.Cn1ncnc1CN1CCCCC1CN |
| InChI | InChI=1S/C10H19N5.2ClH/c1-14-10(12-8-13-14)7-15-5-3-2-4-9(15)6-11;;/h8-9H,2-7,11H2,1H3;2*1H |
| InChIKey | LSZKNCUZPZBBBN-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.22 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-[(2-methyl-1,2,4-triazol-3-yl)methyl]piperidin-2-yl]methanamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(2-methyl-1,2,4-triazol-3-yl)methyl]piperidin-2-yl]methanamine;dihydrochloride?
The IUPAC name of [1-[(2-methyl-1,2,4-triazol-3-yl)methyl]piperidin-2-yl]methanamine;dihydrochloride (CID 119916298) is [1-[(2-methyl-1,2,4-triazol-3-yl)methyl]piperidin-2-yl]methanamine;dihydrochloride.
What is the SMILES notation for [1-[(2-methyl-1,2,4-triazol-3-yl)methyl]piperidin-2-yl]methanamine;dihydrochloride?
The canonical SMILES for [1-[(2-methyl-1,2,4-triazol-3-yl)methyl]piperidin-2-yl]methanamine;dihydrochloride is Cl.Cl.Cn1ncnc1CN1CCCCC1CN.
What is the InChIKey of [1-[(2-methyl-1,2,4-triazol-3-yl)methyl]piperidin-2-yl]methanamine;dihydrochloride?
The InChIKey is LSZKNCUZPZBBBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N5.2ClH/c1-14-10(12-8-13-14)7-15-5-3-2-4-9(15)6-11;;/h8-9H,2-7,11H2,1H3;2*1H.
What are the key properties of [1-[(2-methyl-1,2,4-triazol-3-yl)methyl]piperidin-2-yl]methanamine;dihydrochloride?
[1-[(2-methyl-1,2,4-triazol-3-yl)methyl]piperidin-2-yl]methanamine;dihydrochloride has a molecular weight of 282.22 g/mol, XLogP of 0.97, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(2-methyl-1,2,4-triazol-3-yl)methyl]piperidin-2-yl]methanamine;dihydrochloride is sourced from PubChem (CID 119916298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).