C15H23Cl2N3O — CID 119916653
N-(2-aminoethyl)-1-[(4-chlorophenyl)methyl]piperidine-3-carboxamide;hydrochloride (PubChem CID 119916653) has the molecular formula C15H23Cl2N3O and a molecular weight of 332.27 g/mol. Its IUPAC name is N-(2-aminoethyl)-1-[(4-chlorophenyl)methyl]piperidine-3-carboxamide;hydrochloride.
| Compound Name | N-(2-aminoethyl)-1-[(4-chlorophenyl)methyl]piperidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119916653 |
| Molecular Formula | C15H23Cl2N3O |
| Molecular Weight | 332.27 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | N-(2-aminoethyl)-1-[(4-chlorophenyl)methyl]piperidine-3-carboxamide;hydrochloride |
| SMILES | Cl.NCCNC(=O)C1CCCN(Cc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C15H22ClN3O.ClH/c16-14-5-3-12(4-6-14)10-19-9-1-2-13(11-19)15(20)18-8-7-17;/h3-6,13H,1-2,7-11,17H2,(H,18,20);1H |
| InChIKey | LMDHIHZIJGOOIO-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.27 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |