C21H31NO2Se — CID 11991681
(3S,6R,8R,10S,13R)-2,2,6-trimethyl-13-(phenylselanylmethyl)-9,12-dioxa-1-azatricyclo[8.4.0.03,8]tetradecane (PubChem CID 11991681) has the molecular formula C21H31NO2Se and a molecular weight of 408.44 g/mol. Its IUPAC name is (3S,6R,8R,10S,13R)-2,2,6-trimethyl-13-(phenylselanylmethyl)-9,12-dioxa-1-azatricyclo[8.4.0.03,8]tetradecane.
| Compound Name | (3S,6R,8R,10S,13R)-2,2,6-trimethyl-13-(phenylselanylmethyl)-9,12-dioxa-1-azatricyclo[8.4.0.03,8]tetradecane |
|---|---|
| PubChem CID | 11991681 |
| Molecular Formula | C21H31NO2Se |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | (3S,6R,8R,10S,13R)-2,2,6-trimethyl-13-(phenylselanylmethyl)-9,12-dioxa-1-azatricyclo[8.4.0.03,8]tetradecane |
| SMILES | C[C@@H]1CC[C@@H]2[C@@H](C1)O[C@H]1CO[C@@H](C[Se]c3ccccc3)CN1C2(C)C |
| InChI | InChI=1S/C21H31NO2Se/c1-15-9-10-18-19(11-15)24-20-13-23-16(12-22(20)21(18,2)3)14-25-17-7-5-4-6-8-17/h4-8,15-16,18-20H,9-14H2,1-3H3/t15-,16-,18-,19-,20+/m1/s1 |
| InChIKey | MMVIVUSYUHOPTE-BDUQCRIQSA-N |
| XLogP | 3.07 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|