C18H32F3NO4Si — CID 11991761
tert-butyl (Z)-6-[tert-butyl(dimethyl)silyl]oxy-2-[(2,2,2-trifluoroacetyl)amino]hex-4-enoate (PubChem CID 11991761) has the molecular formula C18H32F3NO4Si and a molecular weight of 411.54 g/mol. Its IUPAC name is tert-butyl (Z)-6-[tert-butyl(dimethyl)silyl]oxy-2-[(2,2,2-trifluoroacetyl)amino]hex-4-enoate.
| Compound Name | tert-butyl (Z)-6-[tert-butyl(dimethyl)silyl]oxy-2-[(2,2,2-trifluoroacetyl)amino]hex-4-enoate |
|---|---|
| PubChem CID | 11991761 |
| Molecular Formula | C18H32F3NO4Si |
| Molecular Weight | 411.54 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | tert-butyl (Z)-6-[tert-butyl(dimethyl)silyl]oxy-2-[(2,2,2-trifluoroacetyl)amino]hex-4-enoate |
| SMILES | CC(C)(C)OC(=O)C(C/C=C\CO[Si](C)(C)C(C)(C)C)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C18H32F3NO4Si/c1-16(2,3)26-14(23)13(22-15(24)18(19,20)21)11-9-10-12-25-27(7,8)17(4,5)6/h9-10,13H,11-12H2,1-8H3,(H,22,24)/b10-9- |
| InChIKey | AKMCNHIMMQGINK-KTKRTIGZSA-N |
| XLogP | 4.34 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.54 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|