C23H35NO2 — CID 11991841
(3S,6R,8R,10S,11S,13R)-2,2,6-trimethyl-11-phenyl-13-propan-2-yl-9,12-dioxa-1-azatricyclo[8.4.0.03,8]tetradecane (PubChem CID 11991841) has the molecular formula C23H35NO2 and a molecular weight of 357.54 g/mol. Its IUPAC name is (3S,6R,8R,10S,11S,13R)-2,2,6-trimethyl-11-phenyl-13-propan-2-yl-9,12-dioxa-1-azatricyclo[8.4.0.03,8]tetradecane.
| Compound Name | (3S,6R,8R,10S,11S,13R)-2,2,6-trimethyl-11-phenyl-13-propan-2-yl-9,12-dioxa-1-azatricyclo[8.4.0.03,8]tetradecane |
|---|---|
| PubChem CID | 11991841 |
| Molecular Formula | C23H35NO2 |
| Molecular Weight | 357.54 g/mol |
| Exact Mass | 357.27 |
| IUPAC Name | (3S,6R,8R,10S,11S,13R)-2,2,6-trimethyl-11-phenyl-13-propan-2-yl-9,12-dioxa-1-azatricyclo[8.4.0.03,8]tetradecane |
| SMILES | CC(C)[C@@H]1CN2[C@@H](O[C@@H]3C[C@H](C)CC[C@H]3C2(C)C)[C@H](c2ccccc2)O1 |
| InChI | InChI=1S/C23H35NO2/c1-15(2)20-14-24-22(21(25-20)17-9-7-6-8-10-17)26-19-13-16(3)11-12-18(19)23(24,4)5/h6-10,15-16,18-22H,11-14H2,1-5H3/t16-,18-,19-,20+,21+,22+/m1/s1 |
| InChIKey | HUPWMWZOZULOID-GDGLQOOESA-N |
| XLogP | 5.02 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.54 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |