C20H26F3NO4 — CID 11991848
tert-butyl (Z,2R,6S)-6-phenylmethoxy-2-[(2,2,2-trifluoroacetyl)amino]hept-4-enoate (PubChem CID 11991848) has the molecular formula C20H26F3NO4 and a molecular weight of 401.43 g/mol. Its IUPAC name is tert-butyl (Z,2R,6S)-6-phenylmethoxy-2-[(2,2,2-trifluoroacetyl)amino]hept-4-enoate.
| Compound Name | tert-butyl (Z,2R,6S)-6-phenylmethoxy-2-[(2,2,2-trifluoroacetyl)amino]hept-4-enoate |
|---|---|
| PubChem CID | 11991848 |
| Molecular Formula | C20H26F3NO4 |
| Molecular Weight | 401.43 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | tert-butyl (Z,2R,6S)-6-phenylmethoxy-2-[(2,2,2-trifluoroacetyl)amino]hept-4-enoate |
| SMILES | C[C@@H](/C=C\C[C@@H](NC(=O)C(F)(F)F)C(=O)OC(C)(C)C)OCc1ccccc1 |
| InChI | InChI=1S/C20H26F3NO4/c1-14(27-13-15-10-6-5-7-11-15)9-8-12-16(17(25)28-19(2,3)4)24-18(26)20(21,22)23/h5-11,14,16H,12-13H2,1-4H3,(H,24,26)/b9-8-/t14-,16+/m0/s1 |
| InChIKey | XWQIVHWPBZHAKQ-AYPLEAKFSA-N |
| XLogP | 3.93 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.43 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|