C28H36F3NO4Si — CID 11991849
tert-butyl (Z)-6-[tert-butyl(diphenyl)silyl]oxy-2-[(2,2,2-trifluoroacetyl)amino]hex-4-enoate (PubChem CID 11991849) has the molecular formula C28H36F3NO4Si and a molecular weight of 535.68 g/mol. Its IUPAC name is tert-butyl (Z)-6-[tert-butyl(diphenyl)silyl]oxy-2-[(2,2,2-trifluoroacetyl)amino]hex-4-enoate.
| Compound Name | tert-butyl (Z)-6-[tert-butyl(diphenyl)silyl]oxy-2-[(2,2,2-trifluoroacetyl)amino]hex-4-enoate |
|---|---|
| PubChem CID | 11991849 |
| Molecular Formula | C28H36F3NO4Si |
| Molecular Weight | 535.68 g/mol |
| Exact Mass | 535.24 |
| IUPAC Name | tert-butyl (Z)-6-[tert-butyl(diphenyl)silyl]oxy-2-[(2,2,2-trifluoroacetyl)amino]hex-4-enoate |
| SMILES | CC(C)(C)OC(=O)C(C/C=C\CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C28H36F3NO4Si/c1-26(2,3)36-24(33)23(32-25(34)28(29,30)31)19-13-14-20-35-37(27(4,5)6,21-15-9-7-10-16-21)22-17-11-8-12-18-22/h7-18,23H,19-20H2,1-6H3,(H,32,34)/b14-13- |
| InChIKey | QSZGIQUTQAVGRT-YPKPFQOOSA-N |
| XLogP | 4.90 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.68 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|