About 2-(7-phenylheptanoyl)-1,3-oxazole-5-carbonitrile
2-(7-phenylheptanoyl)-1,3-oxazole-5-carbonitrile (PubChem CID 11991895) has the molecular formula C17H18N2O2
and a molecular weight of 282.34 g/mol. Its IUPAC name is 2-(7-phenylheptanoyl)-1,3-oxazole-5-carbonitrile.
Molecular Properties
| Compound Name | 2-(7-phenylheptanoyl)-1,3-oxazole-5-carbonitrile |
| PubChem CID | 11991895 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 2-(7-phenylheptanoyl)-1,3-oxazole-5-carbonitrile |
| SMILES | N#Cc1cnc(C(=O)CCCCCCc2ccccc2)o1 |
| InChI | InChI=1S/C17H18N2O2/c18-12-15-13-19-17(21-15)16(20)11-7-2-1-4-8-14-9-5-3-6-10-14/h3,5-6,9-10,13H,1-2,4,7-8,11H2 |
| InChIKey | JOWNZAGZZQQDKI-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 66.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(7-phenylheptanoyl)-1,3-oxazole-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(7-phenylheptanoyl)-1,3-oxazole-5-carbonitrile?
The IUPAC name of 2-(7-phenylheptanoyl)-1,3-oxazole-5-carbonitrile (CID 11991895) is 2-(7-phenylheptanoyl)-1,3-oxazole-5-carbonitrile.
What is the SMILES notation for 2-(7-phenylheptanoyl)-1,3-oxazole-5-carbonitrile?
The canonical SMILES for 2-(7-phenylheptanoyl)-1,3-oxazole-5-carbonitrile is N#Cc1cnc(C(=O)CCCCCCc2ccccc2)o1.
What is the InChIKey of 2-(7-phenylheptanoyl)-1,3-oxazole-5-carbonitrile?
The InChIKey is JOWNZAGZZQQDKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N2O2/c18-12-15-13-19-17(21-15)16(20)11-7-2-1-4-8-14-9-5-3-6-10-14/h3,5-6,9-10,13H,1-2,4,7-8,11H2.
What are the key properties of 2-(7-phenylheptanoyl)-1,3-oxazole-5-carbonitrile?
2-(7-phenylheptanoyl)-1,3-oxazole-5-carbonitrile has a molecular weight of 282.34 g/mol, XLogP of 3.92, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(7-phenylheptanoyl)-1,3-oxazole-5-carbonitrile is sourced from PubChem (CID 11991895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).