C17H31NO2 — CID 11991923
(3S,6R,8R,10S,13R)-2,2,6-trimethyl-13-propan-2-yl-9,12-dioxa-1-azatricyclo[8.4.0.03,8]tetradecane (PubChem CID 11991923) has the molecular formula C17H31NO2 and a molecular weight of 281.44 g/mol. Its IUPAC name is (3S,6R,8R,10S,13R)-2,2,6-trimethyl-13-propan-2-yl-9,12-dioxa-1-azatricyclo[8.4.0.03,8]tetradecane.
| Compound Name | (3S,6R,8R,10S,13R)-2,2,6-trimethyl-13-propan-2-yl-9,12-dioxa-1-azatricyclo[8.4.0.03,8]tetradecane |
|---|---|
| PubChem CID | 11991923 |
| Molecular Formula | C17H31NO2 |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.24 |
| IUPAC Name | (3S,6R,8R,10S,13R)-2,2,6-trimethyl-13-propan-2-yl-9,12-dioxa-1-azatricyclo[8.4.0.03,8]tetradecane |
| SMILES | CC(C)[C@@H]1CN2[C@H](CO1)O[C@@H]1C[C@H](C)CC[C@H]1C2(C)C |
| InChI | InChI=1S/C17H31NO2/c1-11(2)15-9-18-16(10-19-15)20-14-8-12(3)6-7-13(14)17(18,4)5/h11-16H,6-10H2,1-5H3/t12-,13-,14-,15+,16+/m1/s1 |
| InChIKey | OGOVNHDHYXAWJO-SUJAAXHWSA-N |
| XLogP | 3.28 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |