C15H24ClN3O2 — CID 119919921
N-(2-methoxyphenyl)-2-[3-(methylamino)piperidin-1-yl]acetamide;hydrochloride (PubChem CID 119919921) has the molecular formula C15H24ClN3O2 and a molecular weight of 313.83 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-2-[3-(methylamino)piperidin-1-yl]acetamide;hydrochloride.
| Compound Name | N-(2-methoxyphenyl)-2-[3-(methylamino)piperidin-1-yl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 119919921 |
| Molecular Formula | C15H24ClN3O2 |
| Molecular Weight | 313.83 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | N-(2-methoxyphenyl)-2-[3-(methylamino)piperidin-1-yl]acetamide;hydrochloride |
| SMILES | CNC1CCCN(CC(=O)Nc2ccccc2OC)C1.Cl |
| InChI | InChI=1S/C15H23N3O2.ClH/c1-16-12-6-5-9-18(10-12)11-15(19)17-13-7-3-4-8-14(13)20-2;/h3-4,7-8,12,16H,5-6,9-11H2,1-2H3,(H,17,19);1H |
| InChIKey | CEBQZTDLTSKMPT-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.83 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |