C38H54O4Si — CID 11992053
(E)-4-[(1R,2R,3aS,6aS)-2-[tert-butyl(dimethyl)silyl]oxy-5-[5-[(4-methoxyphenyl)methoxy]pentyl]-1,2,3,3a,6,6a-hexahydropentalen-1-yl]-1-(3-methylphenyl)but-3-en-2-one (PubChem CID 11992053) has the molecular formula C38H54O4Si and a molecular weight of 602.93 g/mol. Its IUPAC name is (E)-4-[(1R,2R,3aS,6aS)-2-[tert-butyl(dimethyl)silyl]oxy-5-[5-[(4-methoxyphenyl)methoxy]pentyl]-1,2,3,3a,6,6a-hexahydropentalen-1-yl]-1-(3-methylphenyl)but-3-en-2-one.
| Compound Name | (E)-4-[(1R,2R,3aS,6aS)-2-[tert-butyl(dimethyl)silyl]oxy-5-[5-[(4-methoxyphenyl)methoxy]pentyl]-1,2,3,3a,6,6a-hexahydropentalen-1-yl]-1-(3-methylphenyl)but-3-en-2-one |
|---|---|
| PubChem CID | 11992053 |
| Molecular Formula | C38H54O4Si |
| Molecular Weight | 602.93 g/mol |
| Exact Mass | 602.38 |
| IUPAC Name | (E)-4-[(1R,2R,3aS,6aS)-2-[tert-butyl(dimethyl)silyl]oxy-5-[5-[(4-methoxyphenyl)methoxy]pentyl]-1,2,3,3a,6,6a-hexahydropentalen-1-yl]-1-(3-methylphenyl)but-3-en-2-one |
| SMILES | COc1ccc(COCCCCCC2=C[C@H]3C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](/C=C/C(=O)Cc4cccc(C)c4)[C@H]3C2)cc1 |
| InChI | InChI=1S/C38H54O4Si/c1-28-12-11-14-30(22-28)24-33(39)17-20-35-36-25-31(23-32(36)26-37(35)42-43(6,7)38(2,3)4)13-9-8-10-21-41-27-29-15-18-34(40-5)19-16-29/h11-12,14-20,22-23,32,35-37H,8-10,13,21,24-27H2,1-7H3/b20-17+/t32-,35+,36-,37+/m0/s1 |
| InChIKey | GAIBELLFLBXETK-YRCKGHGXSA-N |
| XLogP | 9.42 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.93 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|