C13H13Cl3OSe — CID 11992070
(1R,3R,4S,6R)-6-phenylselanyl-3-(trichloromethyl)-2-oxabicyclo[2.2.1]heptane (PubChem CID 11992070) has the molecular formula C13H13Cl3OSe and a molecular weight of 370.57 g/mol. Its IUPAC name is (1R,3R,4S,6R)-6-phenylselanyl-3-(trichloromethyl)-2-oxabicyclo[2.2.1]heptane.
| Compound Name | (1R,3R,4S,6R)-6-phenylselanyl-3-(trichloromethyl)-2-oxabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 11992070 |
| Molecular Formula | C13H13Cl3OSe |
| Molecular Weight | 370.57 g/mol |
| Exact Mass | 369.92 |
| IUPAC Name | (1R,3R,4S,6R)-6-phenylselanyl-3-(trichloromethyl)-2-oxabicyclo[2.2.1]heptane |
| SMILES | ClC(Cl)(Cl)[C@@H]1O[C@@H]2C[C@H]1C[C@H]2[Se]c1ccccc1 |
| InChI | InChI=1S/C13H13Cl3OSe/c14-13(15,16)12-8-6-10(17-12)11(7-8)18-9-4-2-1-3-5-9/h1-5,8,10-12H,6-7H2/t8-,10+,11+,12+/m0/s1 |
| InChIKey | VYOYIUZUNHVJPE-JTLRNRKASA-N |
| XLogP | 3.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.57 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|