About 1-[1-[(2-propyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]ethanamine;dihydrochloride
1-[1-[(2-propyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]ethanamine;dihydrochloride (PubChem CID 119920780) has the molecular formula C14H27Cl2N3S
and a molecular weight of 340.36 g/mol. Its IUPAC name is 1-[1-[(2-propyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]ethanamine;dihydrochloride.
Molecular Properties
| Compound Name | 1-[1-[(2-propyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]ethanamine;dihydrochloride |
| PubChem CID | 119920780 |
| Molecular Formula | C14H27Cl2N3S |
| Molecular Weight | 340.36 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 1-[1-[(2-propyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]ethanamine;dihydrochloride |
| SMILES | CCCc1nc(CN2CCC(C(C)N)CC2)cs1.Cl.Cl |
| InChI | InChI=1S/C14H25N3S.2ClH/c1-3-4-14-16-13(10-18-14)9-17-7-5-12(6-8-17)11(2)15;;/h10-12H,3-9,15H2,1-2H3;2*1H |
| InChIKey | YWPLSSZMGYNTDO-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.36 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[1-[(2-propyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]ethanamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-[(2-propyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]ethanamine;dihydrochloride?
The IUPAC name of 1-[1-[(2-propyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]ethanamine;dihydrochloride (CID 119920780) is 1-[1-[(2-propyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]ethanamine;dihydrochloride.
What is the SMILES notation for 1-[1-[(2-propyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]ethanamine;dihydrochloride?
The canonical SMILES for 1-[1-[(2-propyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]ethanamine;dihydrochloride is CCCc1nc(CN2CCC(C(C)N)CC2)cs1.Cl.Cl.
What is the InChIKey of 1-[1-[(2-propyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]ethanamine;dihydrochloride?
The InChIKey is YWPLSSZMGYNTDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25N3S.2ClH/c1-3-4-14-16-13(10-18-14)9-17-7-5-12(6-8-17)11(2)15;;/h10-12H,3-9,15H2,1-2H3;2*1H.
What are the key properties of 1-[1-[(2-propyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]ethanamine;dihydrochloride?
1-[1-[(2-propyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]ethanamine;dihydrochloride has a molecular weight of 340.36 g/mol, XLogP of 3.50, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-[(2-propyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]ethanamine;dihydrochloride is sourced from PubChem (CID 119920780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).