C16H26ClN3O — CID 119920938
2-[4-(1-aminoethyl)piperidin-1-yl]-N-(2-methylphenyl)acetamide;hydrochloride (PubChem CID 119920938) has the molecular formula C16H26ClN3O and a molecular weight of 311.86 g/mol. Its IUPAC name is 2-[4-(1-aminoethyl)piperidin-1-yl]-N-(2-methylphenyl)acetamide;hydrochloride.
| Compound Name | 2-[4-(1-aminoethyl)piperidin-1-yl]-N-(2-methylphenyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119920938 |
| Molecular Formula | C16H26ClN3O |
| Molecular Weight | 311.86 g/mol |
| Exact Mass | 311.18 |
| IUPAC Name | 2-[4-(1-aminoethyl)piperidin-1-yl]-N-(2-methylphenyl)acetamide;hydrochloride |
| SMILES | Cc1ccccc1NC(=O)CN1CCC(C(C)N)CC1.Cl |
| InChI | InChI=1S/C16H25N3O.ClH/c1-12-5-3-4-6-15(12)18-16(20)11-19-9-7-14(8-10-19)13(2)17;/h3-6,13-14H,7-11,17H2,1-2H3,(H,18,20);1H |
| InChIKey | QFUDZTOCYURIHE-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.86 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |