C17H29ClN2O2 — CID 119921928
N-methyl-1-[1-[2-(4-propoxyphenoxy)ethyl]pyrrolidin-3-yl]methanamine;hydrochloride (PubChem CID 119921928) has the molecular formula C17H29ClN2O2 and a molecular weight of 328.88 g/mol. Its IUPAC name is N-methyl-1-[1-[2-(4-propoxyphenoxy)ethyl]pyrrolidin-3-yl]methanamine;hydrochloride.
| Compound Name | N-methyl-1-[1-[2-(4-propoxyphenoxy)ethyl]pyrrolidin-3-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 119921928 |
| Molecular Formula | C17H29ClN2O2 |
| Molecular Weight | 328.88 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | N-methyl-1-[1-[2-(4-propoxyphenoxy)ethyl]pyrrolidin-3-yl]methanamine;hydrochloride |
| SMILES | CCCOc1ccc(OCCN2CCC(CNC)C2)cc1.Cl |
| InChI | InChI=1S/C17H28N2O2.ClH/c1-3-11-20-16-4-6-17(7-5-16)21-12-10-19-9-8-15(14-19)13-18-2;/h4-7,15,18H,3,8-14H2,1-2H3;1H |
| InChIKey | HNDRKXHRGTYDBI-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.88 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |