C20H27ClN2O — CID 119922021
N-methyl-1-[1-[(4-phenylmethoxyphenyl)methyl]pyrrolidin-3-yl]methanamine;hydrochloride (PubChem CID 119922021) has the molecular formula C20H27ClN2O and a molecular weight of 346.90 g/mol. Its IUPAC name is N-methyl-1-[1-[(4-phenylmethoxyphenyl)methyl]pyrrolidin-3-yl]methanamine;hydrochloride.
| Compound Name | N-methyl-1-[1-[(4-phenylmethoxyphenyl)methyl]pyrrolidin-3-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 119922021 |
| Molecular Formula | C20H27ClN2O |
| Molecular Weight | 346.90 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | N-methyl-1-[1-[(4-phenylmethoxyphenyl)methyl]pyrrolidin-3-yl]methanamine;hydrochloride |
| SMILES | CNCC1CCN(Cc2ccc(OCc3ccccc3)cc2)C1.Cl |
| InChI | InChI=1S/C20H26N2O.ClH/c1-21-13-19-11-12-22(15-19)14-17-7-9-20(10-8-17)23-16-18-5-3-2-4-6-18;/h2-10,19,21H,11-16H2,1H3;1H |
| InChIKey | GWKWBDMUDYLRMA-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.90 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |