C17H15Cl2N3O2S — CID 11992203
N-[(Z)-1-(2,5-dichlorothiophen-3-yl)ethylideneamino]-2-oxo-4-phenylpyrrolidine-3-carboxamide (PubChem CID 11992203) has the molecular formula C17H15Cl2N3O2S and a molecular weight of 396.30 g/mol. Its IUPAC name is N-[(Z)-1-(2,5-dichlorothiophen-3-yl)ethylideneamino]-2-oxo-4-phenylpyrrolidine-3-carboxamide.
| Compound Name | N-[(Z)-1-(2,5-dichlorothiophen-3-yl)ethylideneamino]-2-oxo-4-phenylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 11992203 |
| Molecular Formula | C17H15Cl2N3O2S |
| Molecular Weight | 396.30 g/mol |
| Exact Mass | 395.03 |
| IUPAC Name | N-[(Z)-1-(2,5-dichlorothiophen-3-yl)ethylideneamino]-2-oxo-4-phenylpyrrolidine-3-carboxamide |
| SMILES | C/C(=N/NC(=O)C1C(=O)NCC1c1ccccc1)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C17H15Cl2N3O2S/c1-9(11-7-13(18)25-15(11)19)21-22-17(24)14-12(8-20-16(14)23)10-5-3-2-4-6-10/h2-7,12,14H,8H2,1H3,(H,20,23)(H,22,24)/b21-9- |
| InChIKey | PZFONNKWSQRUQQ-NKVSQWTQSA-N |
| XLogP | 3.42 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.30 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|