C19H27ClN2 — CID 119922301
N-methyl-1-[1-(1-naphthalen-2-ylethyl)piperidin-4-yl]methanamine;hydrochloride (PubChem CID 119922301) has the molecular formula C19H27ClN2 and a molecular weight of 318.89 g/mol. Its IUPAC name is N-methyl-1-[1-(1-naphthalen-2-ylethyl)piperidin-4-yl]methanamine;hydrochloride.
| Compound Name | N-methyl-1-[1-(1-naphthalen-2-ylethyl)piperidin-4-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 119922301 |
| Molecular Formula | C19H27ClN2 |
| Molecular Weight | 318.89 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | N-methyl-1-[1-(1-naphthalen-2-ylethyl)piperidin-4-yl]methanamine;hydrochloride |
| SMILES | CNCC1CCN(C(C)c2ccc3ccccc3c2)CC1.Cl |
| InChI | InChI=1S/C19H26N2.ClH/c1-15(21-11-9-16(10-12-21)14-20-2)18-8-7-17-5-3-4-6-19(17)13-18;/h3-8,13,15-16,20H,9-12,14H2,1-2H3;1H |
| InChIKey | SJVQRUYFUXUMLL-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.89 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |