C26H24Cl2N6O3S2 — CID 11992245
2,3-dichloro-N-[4-(13-imino-13-oxo-13λ6-thia-2,4,8,19-tetrazatricyclo[12.3.1.13,7]nonadeca-1(18),3,5,7(19),14,16-hexaen-6-yl)phenyl]benzenesulfonamide (PubChem CID 11992245) has the molecular formula C26H24Cl2N6O3S2 and a molecular weight of 603.56 g/mol. Its IUPAC name is 2,3-dichloro-N-[4-(13-imino-13-oxo-13λ6-thia-2,4,8,19-tetrazatricyclo[12.3.1.13,7]nonadeca-1(18),3,5,7(19),14,16-hexaen-6-yl)phenyl]benzenesulfonamide.
| Compound Name | 2,3-dichloro-N-[4-(13-imino-13-oxo-13λ6-thia-2,4,8,19-tetrazatricyclo[12.3.1.13,7]nonadeca-1(18),3,5,7(19),14,16-hexaen-6-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 11992245 |
| Molecular Formula | C26H24Cl2N6O3S2 |
| Molecular Weight | 603.56 g/mol |
| Exact Mass | 602.07 |
| IUPAC Name | 2,3-dichloro-N-[4-(13-imino-13-oxo-13λ6-thia-2,4,8,19-tetrazatricyclo[12.3.1.13,7]nonadeca-1(18),3,5,7(19),14,16-hexaen-6-yl)phenyl]benzenesulfonamide |
| SMILES | [H]N=S1(=O)CCCCNc2nc(ncc2-c2ccc(NS(=O)(=O)c3cccc(Cl)c3Cl)cc2)Nc2cccc1c2 |
| InChI | InChI=1S/C26H24Cl2N6O3S2/c27-22-7-4-8-23(24(22)28)39(36,37)34-18-11-9-17(10-12-18)21-16-31-26-32-19-5-3-6-20(15-19)38(29,35)14-2-1-13-30-25(21)33-26/h3-12,15-16,29,34H,1-2,13-14H2,(H2,30,31,32,33) |
| InChIKey | DVWQTCFUZPGTJY-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 136.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.56 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |