C18H30ClN3O — CID 119922495
N-benzyl-N-ethyl-2-[4-(methylaminomethyl)piperidin-1-yl]acetamide;hydrochloride (PubChem CID 119922495) has the molecular formula C18H30ClN3O and a molecular weight of 339.91 g/mol. Its IUPAC name is N-benzyl-N-ethyl-2-[4-(methylaminomethyl)piperidin-1-yl]acetamide;hydrochloride.
| Compound Name | N-benzyl-N-ethyl-2-[4-(methylaminomethyl)piperidin-1-yl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 119922495 |
| Molecular Formula | C18H30ClN3O |
| Molecular Weight | 339.91 g/mol |
| Exact Mass | 339.21 |
| IUPAC Name | N-benzyl-N-ethyl-2-[4-(methylaminomethyl)piperidin-1-yl]acetamide;hydrochloride |
| SMILES | CCN(Cc1ccccc1)C(=O)CN1CCC(CNC)CC1.Cl |
| InChI | InChI=1S/C18H29N3O.ClH/c1-3-21(14-17-7-5-4-6-8-17)18(22)15-20-11-9-16(10-12-20)13-19-2;/h4-8,16,19H,3,9-15H2,1-2H3;1H |
| InChIKey | BTRXOBNNTOYYDD-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.91 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |