C19H14F3NO5S — CID 11992263
2-[4-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]-2-(trifluoromethyl)phenoxy]phenyl]acetic acid (PubChem CID 11992263) has the molecular formula C19H14F3NO5S and a molecular weight of 425.38 g/mol. Its IUPAC name is 2-[4-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]-2-(trifluoromethyl)phenoxy]phenyl]acetic acid.
| Compound Name | 2-[4-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]-2-(trifluoromethyl)phenoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 11992263 |
| Molecular Formula | C19H14F3NO5S |
| Molecular Weight | 425.38 g/mol |
| Exact Mass | 425.05 |
| IUPAC Name | 2-[4-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]-2-(trifluoromethyl)phenoxy]phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(Oc2ccc(CC3SC(=O)NC3=O)cc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H14F3NO5S/c20-19(21,22)13-7-11(8-15-17(26)23-18(27)29-15)3-6-14(13)28-12-4-1-10(2-5-12)9-16(24)25/h1-7,15H,8-9H2,(H,24,25)(H,23,26,27) |
| InChIKey | BHGTZFWDUYZUMX-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.38 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|