C15H23Cl2N3O2 — CID 119923559
N-(3-chloro-4-methoxyphenyl)-2-[4-(methylamino)piperidin-1-yl]acetamide;hydrochloride (PubChem CID 119923559) has the molecular formula C15H23Cl2N3O2 and a molecular weight of 348.27 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-2-[4-(methylamino)piperidin-1-yl]acetamide;hydrochloride.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-2-[4-(methylamino)piperidin-1-yl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 119923559 |
| Molecular Formula | C15H23Cl2N3O2 |
| Molecular Weight | 348.27 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-2-[4-(methylamino)piperidin-1-yl]acetamide;hydrochloride |
| SMILES | CNC1CCN(CC(=O)Nc2ccc(OC)c(Cl)c2)CC1.Cl |
| InChI | InChI=1S/C15H22ClN3O2.ClH/c1-17-11-5-7-19(8-6-11)10-15(20)18-12-3-4-14(21-2)13(16)9-12;/h3-4,9,11,17H,5-8,10H2,1-2H3,(H,18,20);1H |
| InChIKey | MEMKDVPNYYYBBP-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.27 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |