C12H24ClN3O2 — CID 119923636
2-[4-(methylamino)piperidin-1-yl]-1-morpholin-4-ylethanone;hydrochloride (PubChem CID 119923636) has the molecular formula C12H24ClN3O2 and a molecular weight of 277.80 g/mol. Its IUPAC name is 2-[4-(methylamino)piperidin-1-yl]-1-morpholin-4-ylethanone;hydrochloride.
| Compound Name | 2-[4-(methylamino)piperidin-1-yl]-1-morpholin-4-ylethanone;hydrochloride |
|---|---|
| PubChem CID | 119923636 |
| Molecular Formula | C12H24ClN3O2 |
| Molecular Weight | 277.80 g/mol |
| Exact Mass | 277.16 |
| IUPAC Name | 2-[4-(methylamino)piperidin-1-yl]-1-morpholin-4-ylethanone;hydrochloride |
| SMILES | CNC1CCN(CC(=O)N2CCOCC2)CC1.Cl |
| InChI | InChI=1S/C12H23N3O2.ClH/c1-13-11-2-4-14(5-3-11)10-12(16)15-6-8-17-9-7-15;/h11,13H,2-10H2,1H3;1H |
| InChIKey | YXHQOTARAHFKDL-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.80 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |