C23H27F2N5O3 — CID 11992406
7-(3,4-difluorophenyl)-1-(2-ethoxyethyl)-3-(2-morpholin-4-ylethylamino)pyrido[3,4-b]pyrazin-2-one (PubChem CID 11992406) has the molecular formula C23H27F2N5O3 and a molecular weight of 459.50 g/mol. Its IUPAC name is 7-(3,4-difluorophenyl)-1-(2-ethoxyethyl)-3-(2-morpholin-4-ylethylamino)pyrido[3,4-b]pyrazin-2-one.
| Compound Name | 7-(3,4-difluorophenyl)-1-(2-ethoxyethyl)-3-(2-morpholin-4-ylethylamino)pyrido[3,4-b]pyrazin-2-one |
|---|---|
| PubChem CID | 11992406 |
| Molecular Formula | C23H27F2N5O3 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.21 |
| IUPAC Name | 7-(3,4-difluorophenyl)-1-(2-ethoxyethyl)-3-(2-morpholin-4-ylethylamino)pyrido[3,4-b]pyrazin-2-one |
| SMILES | CCOCCn1c(=O)c(NCCN2CCOCC2)nc2cnc(-c3ccc(F)c(F)c3)cc21 |
| InChI | InChI=1S/C23H27F2N5O3/c1-2-32-12-9-30-21-14-19(16-3-4-17(24)18(25)13-16)27-15-20(21)28-22(23(30)31)26-5-6-29-7-10-33-11-8-29/h3-4,13-15H,2,5-12H2,1H3,(H,26,28) |
| InChIKey | SAAFIWLGTVESHU-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|