C34H37N3O3 — CID 11992441
(3R,4S)-N-cyclopropyl-4-dibenzofuran-4-yl-N-[[1-(3-methoxypropyl)indol-3-yl]methyl]piperidine-3-carboxamide (PubChem CID 11992441) has the molecular formula C34H37N3O3 and a molecular weight of 535.69 g/mol. Its IUPAC name is (3R,4S)-N-cyclopropyl-4-dibenzofuran-4-yl-N-[[1-(3-methoxypropyl)indol-3-yl]methyl]piperidine-3-carboxamide.
| Compound Name | (3R,4S)-N-cyclopropyl-4-dibenzofuran-4-yl-N-[[1-(3-methoxypropyl)indol-3-yl]methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 11992441 |
| Molecular Formula | C34H37N3O3 |
| Molecular Weight | 535.69 g/mol |
| Exact Mass | 535.28 |
| IUPAC Name | (3R,4S)-N-cyclopropyl-4-dibenzofuran-4-yl-N-[[1-(3-methoxypropyl)indol-3-yl]methyl]piperidine-3-carboxamide |
| SMILES | COCCCn1cc(CN(C(=O)[C@H]2CNCC[C@@H]2c2cccc3c2oc2ccccc23)C2CC2)c2ccccc21 |
| InChI | InChI=1S/C34H37N3O3/c1-39-19-7-18-36-21-23(25-8-2-4-12-31(25)36)22-37(24-14-15-24)34(38)30-20-35-17-16-26(30)28-10-6-11-29-27-9-3-5-13-32(27)40-33(28)29/h2-6,8-13,21,24,26,30,35H,7,14-20,22H2,1H3/t26-,30+/m1/s1 |
| InChIKey | UELQBSSPCNVZHS-VIZCGCQYSA-N |
| XLogP | 6.46 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.69 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|