C12H26ClN3O — CID 119924545
2-(3-methylpiperazin-1-yl)-N-(2-methylpropyl)propanamide;hydrochloride (PubChem CID 119924545) has the molecular formula C12H26ClN3O and a molecular weight of 263.81 g/mol. Its IUPAC name is 2-(3-methylpiperazin-1-yl)-N-(2-methylpropyl)propanamide;hydrochloride.
| Compound Name | 2-(3-methylpiperazin-1-yl)-N-(2-methylpropyl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 119924545 |
| Molecular Formula | C12H26ClN3O |
| Molecular Weight | 263.81 g/mol |
| Exact Mass | 263.18 |
| IUPAC Name | 2-(3-methylpiperazin-1-yl)-N-(2-methylpropyl)propanamide;hydrochloride |
| SMILES | CC(C)CNC(=O)C(C)N1CCNC(C)C1.Cl |
| InChI | InChI=1S/C12H25N3O.ClH/c1-9(2)7-14-12(16)11(4)15-6-5-13-10(3)8-15;/h9-11,13H,5-8H2,1-4H3,(H,14,16);1H |
| InChIKey | PQJZBJDYDXUVQG-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.81 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |